C11H23N2O2S+ — CID 23582199
2-(2,2-dimethyl-1,3-thiazolidine-4-carbonyl)oxyethyl-trimethylazanium (PubChem CID 23582199) has the molecular formula C11H23N2O2S+ and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-thiazolidine-4-carbonyl)oxyethyl-trimethylazanium.
| Compound Name | 2-(2,2-dimethyl-1,3-thiazolidine-4-carbonyl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 23582199 |
| Molecular Formula | C11H23N2O2S+ |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-thiazolidine-4-carbonyl)oxyethyl-trimethylazanium |
| SMILES | CC1(C)NC(C(=O)OCC[N+](C)(C)C)CS1 |
| InChI | InChI=1S/C11H23N2O2S/c1-11(2)12-9(8-16-11)10(14)15-7-6-13(3,4)5/h9,12H,6-8H2,1-5H3/q+1 |
| InChIKey | RSKVKZIGYRPFTM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|