C22H33N3O3 — CID 30665594
tert-butyl 4-[(2R)-4-methyl-2-phenylpiperazine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 30665594) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl 4-[(2R)-4-methyl-2-phenylpiperazine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R)-4-methyl-2-phenylpiperazine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 30665594 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | tert-butyl 4-[(2R)-4-methyl-2-phenylpiperazine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CN1CCN(C(=O)C2CCN(C(=O)OC(C)(C)C)CC2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H33N3O3/c1-22(2,3)28-21(27)24-12-10-18(11-13-24)20(26)25-15-14-23(4)16-19(25)17-8-6-5-7-9-17/h5-9,18-19H,10-16H2,1-4H3/t19-/m0/s1 |
| InChIKey | OCBSYXVOLLXCRZ-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |