C22H25Cl3N6O2 — CID 3066597
7-[3-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione;dihydrochloride (PubChem CID 3066597) has the molecular formula C22H25Cl3N6O2 and a molecular weight of 511.84 g/mol. Its IUPAC name is 7-[3-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione;dihydrochloride.
| Compound Name | 7-[3-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione;dihydrochloride |
|---|---|
| PubChem CID | 3066597 |
| Molecular Formula | C22H25Cl3N6O2 |
| Molecular Weight | 511.84 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 7-[3-[[(4-chlorophenyl)-pyridin-4-ylmethyl]amino]propyl]-1,3-dimethylpurine-2,6-dione;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)c2c(ncn2CCCNC(c2ccncc2)c2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C22H23ClN6O2.2ClH/c1-27-20-19(21(30)28(2)22(27)31)29(14-26-20)13-3-10-25-18(16-8-11-24-12-9-16)15-4-6-17(23)7-5-15;;/h4-9,11-12,14,18,25H,3,10,13H2,1-2H3;2*1H |
| InChIKey | LMUCCOOVNNQEBC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|