C22H22FN3O5S2 — CID 30666490
N-(2,4-dimethylphenyl)-3-[[(4-fluoro-2-methylphenyl)sulfonylamino]carbamoyl]benzenesulfonamide (PubChem CID 30666490) has the molecular formula C22H22FN3O5S2 and a molecular weight of 491.57 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[[(4-fluoro-2-methylphenyl)sulfonylamino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[[(4-fluoro-2-methylphenyl)sulfonylamino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30666490 |
| Molecular Formula | C22H22FN3O5S2 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[[(4-fluoro-2-methylphenyl)sulfonylamino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NNS(=O)(=O)c3ccc(F)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C22H22FN3O5S2/c1-14-7-9-20(15(2)11-14)25-32(28,29)19-6-4-5-17(13-19)22(27)24-26-33(30,31)21-10-8-18(23)12-16(21)3/h4-13,25-26H,1-3H3,(H,24,27) |
| InChIKey | XJLYSMRGZPGZND-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|