C19H23N3O3S — CID 2692226
3-[(but-1-en-2-ylamino)carbamoyl]-N-(2,4-dimethylphenyl)benzenesulfonamide (PubChem CID 2692226) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-[(but-1-en-2-ylamino)carbamoyl]-N-(2,4-dimethylphenyl)benzenesulfonamide.
| Compound Name | 3-[(but-1-en-2-ylamino)carbamoyl]-N-(2,4-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2692226 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[(but-1-en-2-ylamino)carbamoyl]-N-(2,4-dimethylphenyl)benzenesulfonamide |
| SMILES | C=C(CC)NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-5-15(4)20-21-19(23)16-7-6-8-17(12-16)26(24,25)22-18-10-9-13(2)11-14(18)3/h6-12,20,22H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | LPZDOOTWYXVZDL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|