C30H29N3O3S — CID 2329811
N-(2,4-dimethylphenyl)-3-[[[(E)-1,3-diphenylprop-1-en-2-yl]amino]carbamoyl]benzenesulfonamide (PubChem CID 2329811) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[[[(E)-1,3-diphenylprop-1-en-2-yl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[[[(E)-1,3-diphenylprop-1-en-2-yl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2329811 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[[[(E)-1,3-diphenylprop-1-en-2-yl]amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NN/C(=C/c3ccccc3)Cc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C30H29N3O3S/c1-22-16-17-29(23(2)18-22)33-37(35,36)28-15-9-14-26(21-28)30(34)32-31-27(19-24-10-5-3-6-11-24)20-25-12-7-4-8-13-25/h3-19,21,31,33H,20H2,1-2H3,(H,32,34)/b27-19+ |
| InChIKey | UZRYGHFGNPSABQ-ZXVVBBHZSA-N |
| XLogP | 5.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|