C29H23N3O7S2 — CID 2381880
N-(2,4-dimethylphenyl)-3-[[(9,10,10-trioxothioxanthene-3-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 2381880) has the molecular formula C29H23N3O7S2 and a molecular weight of 589.65 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[[(9,10,10-trioxothioxanthene-3-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[[(9,10,10-trioxothioxanthene-3-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2381880 |
| Molecular Formula | C29H23N3O7S2 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[[(9,10,10-trioxothioxanthene-3-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NNC(=O)c3ccc4c(c3)S(=O)(=O)c3ccccc3C4=O)c2)c(C)c1 |
| InChI | InChI=1S/C29H23N3O7S2/c1-17-10-13-24(18(2)14-17)32-41(38,39)21-7-5-6-19(15-21)28(34)30-31-29(35)20-11-12-23-26(16-20)40(36,37)25-9-4-3-8-22(25)27(23)33/h3-16,32H,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | VDPGXZZWVQVNBN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|