C24H29N3O3S — CID 2392822
N-(2,4-dimethylphenyl)-3-[[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)amino]carbamoyl]benzenesulfonamide (PubChem CID 2392822) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2392822 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[[(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CC1=CC(NNC(=O)c2cccc(S(=O)(=O)Nc3ccc(C)cc3C)c2)=CC(C)(C)C1 |
| InChI | InChI=1S/C24H29N3O3S/c1-16-9-10-22(18(3)11-16)27-31(29,30)21-8-6-7-19(13-21)23(28)26-25-20-12-17(2)14-24(4,5)15-20/h6-13,15,25,27H,14H2,1-5H3,(H,26,28) |
| InChIKey | JNNJFUMFJJWWTD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|