C24H29N3O4S — CID 166402531
3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-[(1R,4R,5S)-5-methoxy-5-methyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide (PubChem CID 166402531) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-[(1R,4R,5S)-5-methoxy-5-methyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-[(1R,4R,5S)-5-methoxy-5-methyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
|---|---|
| PubChem CID | 166402531 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-[(1R,4R,5S)-5-methoxy-5-methyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
| SMILES | CO[C@@]1(C)C[C@H]2C[C@@H]1C/C2=N\NC(=O)c1cccc(S(=O)(=O)Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C24H29N3O4S/c1-15-8-9-21(16(2)10-15)27-32(29,30)20-7-5-6-17(12-20)23(28)26-25-22-13-19-11-18(22)14-24(19,3)31-4/h5-10,12,18-19,27H,11,13-14H2,1-4H3,(H,26,28)/b25-22+/t18-,19-,24+/m1/s1 |
| InChIKey | MPOIVXURDQBJPF-YYTUKUOZSA-N |
| XLogP | 4.03 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|