C16H19BrN2O — CID 2376438
4-bromo-N'-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)benzohydrazide (PubChem CID 2376438) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 4-bromo-N'-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)benzohydrazide.
| Compound Name | 4-bromo-N'-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 2376438 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-bromo-N'-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)benzohydrazide |
| SMILES | CC1=CC(NNC(=O)c2ccc(Br)cc2)=CC(C)(C)C1 |
| InChI | InChI=1S/C16H19BrN2O/c1-11-8-14(10-16(2,3)9-11)18-19-15(20)12-4-6-13(17)7-5-12/h4-8,10,18H,9H2,1-3H3,(H,19,20) |
| InChIKey | RLPCEGIFRSHSBS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|