C21H15F6N3O2 — CID 30677618
N-[3-(6-ethoxypyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 30677618) has the molecular formula C21H15F6N3O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is N-[3-(6-ethoxypyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[3-(6-ethoxypyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 30677618 |
| Molecular Formula | C21H15F6N3O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[3-(6-ethoxypyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CCOc1ccc(-c2cccc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)nn1 |
| InChI | InChI=1S/C21H15F6N3O2/c1-2-32-18-7-6-17(29-30-18)12-4-3-5-16(10-12)28-19(31)13-8-14(20(22,23)24)11-15(9-13)21(25,26)27/h3-11H,2H2,1H3,(H,28,31) |
| InChIKey | TUBKIRNTMDLKKH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |