C24H26N4O4S — CID 30685511
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate (PubChem CID 30685511) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 30685511 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)OCC(=O)C(C#N)=C1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C24H26N4O4S/c1-14-11-19(26-23(31)24(2,3)4)33-20(14)22(30)32-13-18(29)15(12-25)21-27(5)16-9-7-8-10-17(16)28(21)6/h7-11H,13H2,1-6H3,(H,26,31) |
| InChIKey | UKCXQMBPGZLGNA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|