C19H26N2O4S — CID 18130983
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate (PubChem CID 18130983) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18130983 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,2-dimethylpropanoylamino)-3-methylthiophene-2-carboxylate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1sc(NC(=O)C(C)(C)C)cc1C |
| InChI | InChI=1S/C19H26N2O4S/c1-7-9-21(10-8-2)15(22)12-25-17(23)16-13(3)11-14(26-16)20-18(24)19(4,5)6/h7-8,11H,1-2,9-10,12H2,3-6H3,(H,20,24) |
| InChIKey | UGDUOJZSAKBMOE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|