C18H25NO2 — CID 3069303
3-benzyl-5-cyclohexyl-6,8-dioxa-3-azabicyclo[3.2.1]octane (PubChem CID 3069303) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-benzyl-5-cyclohexyl-6,8-dioxa-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-benzyl-5-cyclohexyl-6,8-dioxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 3069303 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-benzyl-5-cyclohexyl-6,8-dioxa-3-azabicyclo[3.2.1]octane |
| SMILES | c1ccc(CN2CC3COC(C4CCCCC4)(C2)O3)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-3-7-15(8-4-1)11-19-12-17-13-20-18(14-19,21-17)16-9-5-2-6-10-16/h1,3-4,7-8,16-17H,2,5-6,9-14H2 |
| InChIKey | GIEFLTRDOWGPCY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |