C18H24N6O4 — CID 30704161
3-nitro-4-[[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methyl]benzamide (PubChem CID 30704161) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-nitro-4-[[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methyl]benzamide.
| Compound Name | 3-nitro-4-[[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 30704161 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-nitro-4-[[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methyl]benzamide |
| SMILES | CC(C)c1noc(CN2CCN(Cc3ccc(C(N)=O)cc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C18H24N6O4/c1-12(2)18-20-16(28-21-18)11-23-7-5-22(6-8-23)10-14-4-3-13(17(19)25)9-15(14)24(26)27/h3-4,9,12H,5-8,10-11H2,1-2H3,(H2,19,25) |
| InChIKey | GTLGBHZSGQZDDV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|