C19H18Cl2N4O4 — CID 37447538
4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-3-nitrobenzamide (PubChem CID 37447538) has the molecular formula C19H18Cl2N4O4 and a molecular weight of 437.28 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-3-nitrobenzamide.
| Compound Name | 4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 37447538 |
| Molecular Formula | C19H18Cl2N4O4 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(CN2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18Cl2N4O4/c20-14-3-4-15(16(21)10-14)19(27)24-7-5-23(6-8-24)11-13-2-1-12(18(22)26)9-17(13)25(28)29/h1-4,9-10H,5-8,11H2,(H2,22,26) |
| InChIKey | KLZZARBPZWMZQF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|