C13H20N2 — CID 3072374
N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine (PubChem CID 3072374) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 3072374 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine |
| SMILES | CN(C)CC1CCCN1c1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-14(2)11-13-9-6-10-15(13)12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3 |
| InChIKey | FTASZDRLMJMLPQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |