C15H28N2O3 — CID 30726501
(2S)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol (PubChem CID 30726501) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2S)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol.
| Compound Name | (2S)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 30726501 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2S)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol |
| SMILES | C#C[C@@](C)(CC)OC[C@@H](O)CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C15H28N2O3/c1-4-15(3,5-2)20-13-14(19)12-17-8-6-16(7-9-17)10-11-18/h1,14,18-19H,5-13H2,2-3H3/t14-,15-/m0/s1 |
| InChIKey | VHMJFQVMQZCSNY-GJZGRUSLSA-N |
| XLogP | -0.22 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|