C19H27FN2O2 — CID 42589230
(2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol (PubChem CID 42589230) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is (2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol.
| Compound Name | (2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 42589230 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2S)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[(3R)-3-methylpent-1-yn-3-yl]oxypropan-2-ol |
| SMILES | C#C[C@@](C)(CC)OC[C@@H](O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN2O2/c1-4-19(3,5-2)24-15-18(23)14-21-10-12-22(13-11-21)17-8-6-16(20)7-9-17/h1,6-9,18,23H,5,10-15H2,2-3H3/t18-,19-/m0/s1 |
| InChIKey | IAFFRPSKIJMCEA-OALUTQOASA-N |
| XLogP | 2.13 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|