C10H15F3N2O4S2 — CID 3073246
S-[2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid (PubChem CID 3073246) has the molecular formula C10H15F3N2O4S2 and a molecular weight of 348.37 g/mol. Its IUPAC name is S-[2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid.
| Compound Name | S-[2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 3073246 |
| Molecular Formula | C10H15F3N2O4S2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | S-[2-[[(4R)-1,3-thiazolidine-4-carbonyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SCCNC(=O)[C@@H]1CSCN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H14N2O2S2.C2HF3O2/c1-6(11)14-3-2-9-8(12)7-4-13-5-10-7;3-2(4,5)1(6)7/h7,10H,2-5H2,1H3,(H,9,12);(H,6,7)/t7-;/m0./s1 |
| InChIKey | UCBPUJBUXMTHPZ-FJXQXJEOSA-N |
| XLogP | 0.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|