C19H21N3O7S — CID 30747968
methyl 6-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)carbamoyl]pyridine-3-carboxylate (PubChem CID 30747968) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is methyl 6-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)carbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 30747968 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | methyl 6-[(4-methoxy-3-morpholin-4-ylsulfonylphenyl)carbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)nc1 |
| InChI | InChI=1S/C19H21N3O7S/c1-27-16-6-4-14(11-17(16)30(25,26)22-7-9-29-10-8-22)21-18(23)15-5-3-13(12-20-15)19(24)28-2/h3-6,11-12H,7-10H2,1-2H3,(H,21,23) |
| InChIKey | RPIGNAQILXWHSK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |