C13H15NO2 — CID 3075489
2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclopentane]-4-ol (PubChem CID 3075489) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclopentane]-4-ol.
| Compound Name | 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclopentane]-4-ol |
|---|---|
| PubChem CID | 3075489 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclopentane]-4-ol |
| SMILES | [O-][N+]1=Cc2ccccc2C(O)C12CCCC2 |
| InChI | InChI=1S/C13H15NO2/c15-12-11-6-2-1-5-10(11)9-14(16)13(12)7-3-4-8-13/h1-2,5-6,9,12,15H,3-4,7-8H2 |
| InChIKey | RKKSUFSNELHBAZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|