About 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate
3-dimethoxyphosphorylpropyl 4-acetamidobutanoate (PubChem CID 3076695) has the molecular formula C11H22NO6P
and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate.
Molecular Properties
| Compound Name | 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate |
| PubChem CID | 3076695 |
| Molecular Formula | C11H22NO6P |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate |
| SMILES | COP(=O)(CCCOC(=O)CCCNC(C)=O)OC |
| InChI | InChI=1S/C11H22NO6P/c1-10(13)12-7-4-6-11(14)18-8-5-9-19(15,16-2)17-3/h4-9H2,1-3H3,(H,12,13) |
| InChIKey | RRTUVQHLPYTNHO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate?
The IUPAC name of 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate (CID 3076695) is 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate.
What is the SMILES notation for 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate?
The canonical SMILES for 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate is COP(=O)(CCCOC(=O)CCCNC(C)=O)OC.
What is the InChIKey of 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate?
The InChIKey is RRTUVQHLPYTNHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22NO6P/c1-10(13)12-7-4-6-11(14)18-8-5-9-19(15,16-2)17-3/h4-9H2,1-3H3,(H,12,13).
What are the key properties of 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate?
3-dimethoxyphosphorylpropyl 4-acetamidobutanoate has a molecular weight of 295.27 g/mol, XLogP of 1.32, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethoxyphosphorylpropyl 4-acetamidobutanoate is sourced from PubChem (CID 3076695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).