About 2-dimethoxyphosphorylethyl 2-acetamidoacetate
2-dimethoxyphosphorylethyl 2-acetamidoacetate (PubChem CID 3073812) has the molecular formula C8H16NO6P
and a molecular weight of 253.19 g/mol. Its IUPAC name is 2-dimethoxyphosphorylethyl 2-acetamidoacetate.
Molecular Properties
| Compound Name | 2-dimethoxyphosphorylethyl 2-acetamidoacetate |
| PubChem CID | 3073812 |
| Molecular Formula | C8H16NO6P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-dimethoxyphosphorylethyl 2-acetamidoacetate |
| SMILES | COP(=O)(CCOC(=O)CNC(C)=O)OC |
| InChI | InChI=1S/C8H16NO6P/c1-7(10)9-6-8(11)15-4-5-16(12,13-2)14-3/h4-6H2,1-3H3,(H,9,10) |
| InChIKey | CBHXIQBYFWYZBB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethoxyphosphorylethyl 2-acetamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethoxyphosphorylethyl 2-acetamidoacetate?
The IUPAC name of 2-dimethoxyphosphorylethyl 2-acetamidoacetate (CID 3073812) is 2-dimethoxyphosphorylethyl 2-acetamidoacetate.
What is the SMILES notation for 2-dimethoxyphosphorylethyl 2-acetamidoacetate?
The canonical SMILES for 2-dimethoxyphosphorylethyl 2-acetamidoacetate is COP(=O)(CCOC(=O)CNC(C)=O)OC.
What is the InChIKey of 2-dimethoxyphosphorylethyl 2-acetamidoacetate?
The InChIKey is CBHXIQBYFWYZBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO6P/c1-7(10)9-6-8(11)15-4-5-16(12,13-2)14-3/h4-6H2,1-3H3,(H,9,10).
What are the key properties of 2-dimethoxyphosphorylethyl 2-acetamidoacetate?
2-dimethoxyphosphorylethyl 2-acetamidoacetate has a molecular weight of 253.19 g/mol, XLogP of 0.15, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethoxyphosphorylethyl 2-acetamidoacetate is sourced from PubChem (CID 3073812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).