C27H35N2O2+ — CID 3077289
3-methyl-4-methylidene-8,8-bis(3-phenylpropyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one (PubChem CID 3077289) has the molecular formula C27H35N2O2+ and a molecular weight of 419.59 g/mol. Its IUPAC name is 3-methyl-4-methylidene-8,8-bis(3-phenylpropyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one.
| Compound Name | 3-methyl-4-methylidene-8,8-bis(3-phenylpropyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 3077289 |
| Molecular Formula | C27H35N2O2+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 3-methyl-4-methylidene-8,8-bis(3-phenylpropyl)-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
| SMILES | C=C1N(C)C(=O)OC12CC[N+](CCCc1ccccc1)(CCCc1ccccc1)CC2 |
| InChI | InChI=1S/C27H35N2O2/c1-23-27(31-26(30)28(23)2)17-21-29(22-18-27,19-9-15-24-11-5-3-6-12-24)20-10-16-25-13-7-4-8-14-25/h3-8,11-14H,1,9-10,15-22H2,2H3/q+1 |
| InChIKey | MIKNNYNDTYTSKU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|