C16H21IN2 — CID 3078426
4-(2,3,3-trimethyl-4H-isoquinolin-2-ium-1-yl)butanenitrile iodide (PubChem CID 3078426) has the molecular formula C16H21IN2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 4-(2,3,3-trimethyl-4H-isoquinolin-2-ium-1-yl)butanenitrile iodide.
| Compound Name | 4-(2,3,3-trimethyl-4H-isoquinolin-2-ium-1-yl)butanenitrile iodide |
|---|---|
| PubChem CID | 3078426 |
| Molecular Formula | C16H21IN2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 4-(2,3,3-trimethyl-4H-isoquinolin-2-ium-1-yl)butanenitrile iodide |
| SMILES | C[N+]1=C(CCCC#N)c2ccccc2CC1(C)C.[I-] |
| InChI | InChI=1S/C16H21N2.HI/c1-16(2)12-13-8-4-5-9-14(13)15(18(16)3)10-6-7-11-17;/h4-5,8-9H,6-7,10,12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CBVPCKKDCBAJFO-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 26.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|