C23H26N4O5S — CID 30788927
N-[5-(diethylsulfamoyl)-2-(3-methylphenoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 30788927) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(3-methylphenoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(3-methylphenoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 30788927 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(3-methylphenoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Oc2cccc(C)c2)c(NC(=O)c2ccc(=O)n(C)n2)c1 |
| InChI | InChI=1S/C23H26N4O5S/c1-5-27(6-2)33(30,31)18-10-12-21(32-17-9-7-8-16(3)14-17)20(15-18)24-23(29)19-11-13-22(28)26(4)25-19/h7-15H,5-6H2,1-4H3,(H,24,29) |
| InChIKey | XOBMKINWPQOTSH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |