About 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine
4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine (PubChem CID 3079742) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine |
| PubChem CID | 3079742 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine |
| SMILES | CC1(C)Cc2ccccc2C(CCN2CCOCC2)=N1 |
| InChI | InChI=1S/C17H24N2O/c1-17(2)13-14-5-3-4-6-15(14)16(18-17)7-8-19-9-11-20-12-10-19/h3-6H,7-13H2,1-2H3 |
| InChIKey | UFFBANIKBVWTQU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine?
The IUPAC name of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine (CID 3079742) is 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine.
What is the SMILES notation for 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine?
The canonical SMILES for 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine is CC1(C)Cc2ccccc2C(CCN2CCOCC2)=N1.
What is the InChIKey of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine?
The InChIKey is UFFBANIKBVWTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-17(2)13-14-5-3-4-6-15(14)16(18-17)7-8-19-9-11-20-12-10-19/h3-6H,7-13H2,1-2H3.
What are the key properties of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine?
4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine has a molecular weight of 272.39 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)ethyl]morpholine is sourced from PubChem (CID 3079742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).