C19H21Cl2NO5 — CID 3079814
2-[(2-chlorophenyl)-(3-chlorophenyl)methoxy]-N,N-dimethylethanamine;oxalic acid (PubChem CID 3079814) has the molecular formula C19H21Cl2NO5 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)-(3-chlorophenyl)methoxy]-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-[(2-chlorophenyl)-(3-chlorophenyl)methoxy]-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 3079814 |
| Molecular Formula | C19H21Cl2NO5 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[(2-chlorophenyl)-(3-chlorophenyl)methoxy]-N,N-dimethylethanamine;oxalic acid |
| SMILES | CN(C)CCOC(c1cccc(Cl)c1)c1ccccc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H19Cl2NO.C2H2O4/c1-20(2)10-11-21-17(13-6-5-7-14(18)12-13)15-8-3-4-9-16(15)19;3-1(4)2(5)6/h3-9,12,17H,10-11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ORLRUAPABXOIPM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|