C20H23N3O4S2 — CID 30798737
2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-1-propylbenzimidazole-5-sulfonamide (PubChem CID 30798737) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-1-propylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-1-propylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 30798737 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-[(5-acetyl-2-methoxyphenyl)methylsulfanyl]-1-propylbenzimidazole-5-sulfonamide |
| SMILES | CCCn1c(SCc2cc(C(C)=O)ccc2OC)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H23N3O4S2/c1-4-9-23-18-7-6-16(29(21,25)26)11-17(18)22-20(23)28-12-15-10-14(13(2)24)5-8-19(15)27-3/h5-8,10-11H,4,9,12H2,1-3H3,(H2,21,25,26) |
| InChIKey | XJWHFOIWLFJPRG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |