C18H16N4O2S2 — CID 30803808
N-(cyanomethyl)-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-phenylacetamide (PubChem CID 30803808) has the molecular formula C18H16N4O2S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 30803808 |
| Molecular Formula | C18H16N4O2S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-(cyanomethyl)-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-phenylacetamide |
| SMILES | CCn1c(SCC(=O)N(CC#N)c2ccccc2)nc2ccsc2c1=O |
| InChI | InChI=1S/C18H16N4O2S2/c1-2-21-17(24)16-14(8-11-25-16)20-18(21)26-12-15(23)22(10-9-19)13-6-4-3-5-7-13/h3-8,11H,2,10,12H2,1H3 |
| InChIKey | ARKSAEUTKYSAND-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|