C17H10Cl3IN2O2 — CID 3080543
5-[(4-chlorophenyl)methoxy]-2-(3,4-dichlorophenyl)-4-iodopyridazin-3-one (PubChem CID 3080543) has the molecular formula C17H10Cl3IN2O2 and a molecular weight of 507.54 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methoxy]-2-(3,4-dichlorophenyl)-4-iodopyridazin-3-one.
| Compound Name | 5-[(4-chlorophenyl)methoxy]-2-(3,4-dichlorophenyl)-4-iodopyridazin-3-one |
|---|---|
| PubChem CID | 3080543 |
| Molecular Formula | C17H10Cl3IN2O2 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 505.89 |
| IUPAC Name | 5-[(4-chlorophenyl)methoxy]-2-(3,4-dichlorophenyl)-4-iodopyridazin-3-one |
| SMILES | O=c1c(I)c(OCc2ccc(Cl)cc2)cnn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl3IN2O2/c18-11-3-1-10(2-4-11)9-25-15-8-22-23(17(24)16(15)21)12-5-6-13(19)14(20)7-12/h1-8H,9H2 |
| InChIKey | NENSGHXYOXEOOZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|