C19H21N7O — CID 30822093
N-phenyl-N-prop-2-enyl-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide (PubChem CID 30822093) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is N-phenyl-N-prop-2-enyl-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide.
| Compound Name | N-phenyl-N-prop-2-enyl-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30822093 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-phenyl-N-prop-2-enyl-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carboxamide |
| SMILES | C=CCN(C(=O)C1CCN(c2ccc3nnnn3n2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H21N7O/c1-2-12-25(16-6-4-3-5-7-16)19(27)15-10-13-24(14-11-15)18-9-8-17-20-22-23-26(17)21-18/h2-9,15H,1,10-14H2 |
| InChIKey | CDRKGKYFUAQSEC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|