C21H20N4O5S2 — CID 30824099
[2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 30824099) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is [2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 30824099 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(Cc1nc(COC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cs1)NCc1ccccc1 |
| InChI | InChI=1S/C21H20N4O5S2/c26-19(22-11-15-4-2-1-3-5-15)10-20-23-17(14-31-20)13-30-21(27)16-6-7-18-24-32(28,29)9-8-25(18)12-16/h1-7,12,14H,8-11,13H2,(H,22,26) |
| InChIKey | YEYHSYOGUZCELQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |