C16H18N4O5S2 — CID 55370678
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 55370678) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 55370678 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | CCN(C(C)=O)c1nc(COC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cs1 |
| InChI | InChI=1S/C16H18N4O5S2/c1-3-20(11(2)21)16-17-13(10-26-16)9-25-15(22)12-4-5-14-18-27(23,24)7-6-19(14)8-12/h4-5,8,10H,3,6-7,9H2,1-2H3 |
| InChIKey | IBGWUWNTMDIHDY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 109.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |