C18H15N3O5S — CID 31962279
(2-phenyl-1,3-oxazol-4-yl)methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate (PubChem CID 31962279) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 31962279 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxylate |
| SMILES | O=C(OCc1coc(-c2ccccc2)n1)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C18H15N3O5S/c22-18(14-6-7-16-20-27(23,24)9-8-21(16)10-14)26-12-15-11-25-17(19-15)13-4-2-1-3-5-13/h1-7,10-11H,8-9,12H2 |
| InChIKey | NRQFUWNWAZUACL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 102.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |