C17H21N3O5 — CID 30836713
1-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3-[(2-methylfuran-3-carbonyl)amino]urea (PubChem CID 30836713) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3-[(2-methylfuran-3-carbonyl)amino]urea.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3-[(2-methylfuran-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 30836713 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3-[(2-methylfuran-3-carbonyl)amino]urea |
| SMILES | COc1cccc(CN(C)C(=O)NNC(=O)c2ccoc2C)c1OC |
| InChI | InChI=1S/C17H21N3O5/c1-11-13(8-9-25-11)16(21)18-19-17(22)20(2)10-12-6-5-7-14(23-3)15(12)24-4/h5-9H,10H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | JYAARCZNPNQOHQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|