C21H23FN4O5S — CID 30839773
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 30839773) has the molecular formula C21H23FN4O5S and a molecular weight of 462.50 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 30839773 |
| Molecular Formula | C21H23FN4O5S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(6-fluoro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)Cn2cnc3ccc(F)cc3c2=O)c1 |
| InChI | InChI=1S/C21H23FN4O5S/c1-4-26(5-2)32(29,30)15-7-9-19(31-3)18(11-15)24-20(27)12-25-13-23-17-8-6-14(22)10-16(17)21(25)28/h6-11,13H,4-5,12H2,1-3H3,(H,24,27) |
| InChIKey | VECDDYGICCTELI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |