C20H18FN5O6S — CID 30840113
6-fluoro-3-[2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 30840113) has the molecular formula C20H18FN5O6S and a molecular weight of 475.46 g/mol. Its IUPAC name is 6-fluoro-3-[2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 6-fluoro-3-[2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 30840113 |
| Molecular Formula | C20H18FN5O6S |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 6-fluoro-3-[2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2ccc(F)cc2c1=O)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H18FN5O6S/c21-14-1-6-18-17(11-14)20(28)24(13-22-18)12-19(27)23-7-9-25(10-8-23)33(31,32)16-4-2-15(3-5-16)26(29)30/h1-6,11,13H,7-10,12H2 |
| InChIKey | OLVJCUFNINDBBL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|