C21H20FN5O6S — CID 30837290
6-fluoro-3-[2-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 30837290) has the molecular formula C21H20FN5O6S and a molecular weight of 489.49 g/mol. Its IUPAC name is 6-fluoro-3-[2-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 6-fluoro-3-[2-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 30837290 |
| Molecular Formula | C21H20FN5O6S |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 6-fluoro-3-[2-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)Cn3cnc4ccc(F)cc4c3=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20FN5O6S/c1-34(32,33)15-3-5-18(19(11-15)27(30)31)24-6-8-25(9-7-24)20(28)12-26-13-23-17-4-2-14(22)10-16(17)21(26)29/h2-5,10-11,13H,6-9,12H2,1H3 |
| InChIKey | XRZSOOHYKYLPGJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|