C25H28N4O3S — CID 30844895
N-(2-ethylphenyl)-1-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]piperidine-4-carboxamide (PubChem CID 30844895) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-ethylphenyl)-1-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30844895 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-(2-ethylphenyl)-1-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]piperidine-4-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C1CCN(c2ccc(S(=O)(=O)c3ccc(C)cc3)nn2)CC1 |
| InChI | InChI=1S/C25H28N4O3S/c1-3-19-6-4-5-7-22(19)26-25(30)20-14-16-29(17-15-20)23-12-13-24(28-27-23)33(31,32)21-10-8-18(2)9-11-21/h4-13,20H,3,14-17H2,1-2H3,(H,26,30) |
| InChIKey | ATLHTDRZGSBUIS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |