C17H14ClN3 — CID 30851
2-Chloro-4,6-di-p-tolyl-1,3,5-triazine (PubChem CID 30851) has the molecular formula C17H14ClN3 and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-Chloro-4,6-di-p-tolyl-1,3,5-triazine |
|---|---|
| PubChem CID | 30851 |
| Molecular Formula | C17H14ClN3 |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=C(C=C3)C |
| InChI | InChI=1S/C17H14ClN3/c1-11-3-7-13(8-4-11)15-19-16(21-17(18)20-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | LPSLMIOUKRPZDC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 292 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |