C13H28O4 — CID 3086102
2-[(2R)-2-hydroperoxypentan-2-yl]peroxy-2,5-dimethylhexane (PubChem CID 3086102) has the molecular formula C13H28O4 and a molecular weight of 248.36 g/mol. Its IUPAC name is 2-[(2R)-2-hydroperoxypentan-2-yl]peroxy-2,5-dimethylhexane.
| Compound Name | 2-[(2R)-2-hydroperoxypentan-2-yl]peroxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 3086102 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-[(2R)-2-hydroperoxypentan-2-yl]peroxy-2,5-dimethylhexane |
| SMILES | CCC[C@](C)(OO)OOC(C)(C)CCC(C)C |
| InChI | InChI=1S/C13H28O4/c1-7-9-13(6,15-14)17-16-12(4,5)10-8-11(2)3/h11,14H,7-10H2,1-6H3/t13-/m1/s1 |
| InChIKey | UTONNOSUFCFQCP-CYBMUJFWSA-N |
| XLogP | 4.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|