About 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane
2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane (PubChem CID 156888040) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane |
| PubChem CID | 156888040 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane |
| SMILES | CC(C)CCC(C)(C)OOC(C)(C)COO |
| InChI | InChI=1S/C12H26O4/c1-10(2)7-8-11(3,4)15-16-12(5,6)9-14-13/h10,13H,7-9H2,1-6H3 |
| InChIKey | LFLYQKHVLMKZFV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane?
The IUPAC name of 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane (CID 156888040) is 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane.
What is the SMILES notation for 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane?
The canonical SMILES for 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane is CC(C)CCC(C)(C)OOC(C)(C)COO.
What is the InChIKey of 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane?
The InChIKey is LFLYQKHVLMKZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4/c1-10(2)7-8-11(3,4)15-16-12(5,6)9-14-13/h10,13H,7-9H2,1-6H3.
What are the key properties of 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane?
2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane has a molecular weight of 234.34 g/mol, XLogP of 3.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane is sourced from PubChem (CID 156888040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).