C12H26O4 — CID 156888040
2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane (PubChem CID 156888040) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane.
| Compound Name | 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 156888040 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-(1-hydroperoxy-2-methylpropan-2-yl)peroxy-2,5-dimethylhexane |
| SMILES | CC(C)CCC(C)(C)OOC(C)(C)COO |
| InChI | InChI=1S/C12H26O4/c1-10(2)7-8-11(3,4)15-16-12(5,6)9-14-13/h10,13H,7-9H2,1-6H3 |
| InChIKey | LFLYQKHVLMKZFV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|