C17H36O4 — CID 154640882
2-methyl-2,5-bis(2-methylbutan-2-ylperoxy)hexane (PubChem CID 154640882) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-methyl-2,5-bis(2-methylbutan-2-ylperoxy)hexane.
| Compound Name | 2-methyl-2,5-bis(2-methylbutan-2-ylperoxy)hexane |
|---|---|
| PubChem CID | 154640882 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 2-methyl-2,5-bis(2-methylbutan-2-ylperoxy)hexane |
| SMILES | CCC(C)(C)OOC(C)CCC(C)(C)OOC(C)(C)CC |
| InChI | InChI=1S/C17H36O4/c1-10-15(4,5)19-18-14(3)12-13-17(8,9)21-20-16(6,7)11-2/h14H,10-13H2,1-9H3 |
| InChIKey | BOFUTNFDHJUEAG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|