C23H48O4 — CID 6451505
2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane (PubChem CID 6451505) has the molecular formula C23H48O4 and a molecular weight of 388.63 g/mol. Its IUPAC name is 2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane.
| Compound Name | 2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane |
|---|---|
| PubChem CID | 6451505 |
| Molecular Formula | C23H48O4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 388.36 |
| IUPAC Name | 2,3,4,4,5,6-hexamethyl-2,6-bis(2-methylbutan-2-ylperoxy)heptane |
| SMILES | CCC(C)(C)OOC(C)(C)C(C)C(C)(C)C(C)C(C)(C)OOC(C)(C)CC |
| InChI | InChI=1S/C23H48O4/c1-15-19(5,6)24-26-22(11,12)17(3)21(9,10)18(4)23(13,14)27-25-20(7,8)16-2/h17-18H,15-16H2,1-14H3 |
| InChIKey | WRABBTNNJGZXPG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|