C17H25N7O — CID 30877050
4-methoxy-2-[4-[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine (PubChem CID 30877050) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 4-methoxy-2-[4-[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 4-methoxy-2-[4-[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 30877050 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-methoxy-2-[4-[4-(pyrrolidin-1-ylmethyl)triazol-1-yl]piperidin-1-yl]pyrimidine |
| SMILES | COc1ccnc(N2CCC(n3cc(CN4CCCC4)nn3)CC2)n1 |
| InChI | InChI=1S/C17H25N7O/c1-25-16-4-7-18-17(19-16)23-10-5-15(6-11-23)24-13-14(20-21-24)12-22-8-2-3-9-22/h4,7,13,15H,2-3,5-6,8-12H2,1H3 |
| InChIKey | DEDACHRIXMLKSN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |