C12H22S2+2 — CID 3087754
1-methyl-4-(1-methylthian-1-ium-4-yl)-3,6-dihydro-2H-thiopyran-1-ium (PubChem CID 3087754) has the molecular formula C12H22S2+2 and a molecular weight of 230.44 g/mol. Its IUPAC name is 1-methyl-4-(1-methylthian-1-ium-4-yl)-3,6-dihydro-2H-thiopyran-1-ium.
| Compound Name | 1-methyl-4-(1-methylthian-1-ium-4-yl)-3,6-dihydro-2H-thiopyran-1-ium |
|---|---|
| PubChem CID | 3087754 |
| Molecular Formula | C12H22S2+2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-methyl-4-(1-methylthian-1-ium-4-yl)-3,6-dihydro-2H-thiopyran-1-ium |
| SMILES | C[S+]1CC=C(C2CC[S+](C)CC2)CC1 |
| InChI | InChI=1S/C12H22S2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3,12H,4-10H2,1-2H3/q+2 |
| InChIKey | ZWGGNGGTVBODKO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|