C31H44N6O9S2 — CID 3087870
1,3-dimethyl-7-[2-[4-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethyl]purine-2,6-dione;methanesulfonic acid (PubChem CID 3087870) has the molecular formula C31H44N6O9S2 and a molecular weight of 708.86 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[4-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethyl]purine-2,6-dione;methanesulfonic acid.
| Compound Name | 1,3-dimethyl-7-[2-[4-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethyl]purine-2,6-dione;methanesulfonic acid |
|---|---|
| PubChem CID | 3087870 |
| Molecular Formula | C31H44N6O9S2 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | 1,3-dimethyl-7-[2-[4-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethyl]purine-2,6-dione;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Cc1ccc(C(OCCN2CCN(CCn3cnc4c3c(=O)n(C)c(=O)n4C)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H36N6O3.2CH4O3S/c1-22-9-11-24(12-10-22)26(23-7-5-4-6-8-23)38-20-19-34-15-13-33(14-16-34)17-18-35-21-30-27-25(35)28(36)32(3)29(37)31(27)2;2*1-5(2,3)4/h4-12,21,26H,13-20H2,1-3H3;2*1H3,(H,2,3,4) |
| InChIKey | WCQCZKYNBCUJLZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 186.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|