C21H35ClN2O3 — CID 3088524
[4-tert-butyl-3-(3-piperidin-1-ylpropoxy)phenyl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 3088524) has the molecular formula C21H35ClN2O3 and a molecular weight of 398.98 g/mol. Its IUPAC name is [4-tert-butyl-3-(3-piperidin-1-ylpropoxy)phenyl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [4-tert-butyl-3-(3-piperidin-1-ylpropoxy)phenyl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 3088524 |
| Molecular Formula | C21H35ClN2O3 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [4-tert-butyl-3-(3-piperidin-1-ylpropoxy)phenyl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1ccc(C(C)(C)C)c(OCCCN2CCCCC2)c1.Cl |
| InChI | InChI=1S/C21H34N2O3.ClH/c1-21(2,3)18-11-10-17(26-20(24)22(4)5)16-19(18)25-15-9-14-23-12-7-6-8-13-23;/h10-11,16H,6-9,12-15H2,1-5H3;1H |
| InChIKey | JRCMNNRDILQEEV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|